C18H17BrClNO3 — CID 2569917
[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 2569917) has the molecular formula C18H17BrClNO3 and a molecular weight of 410.70 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 2569917 |
| Molecular Formula | C18H17BrClNO3 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(Br)cc1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17BrClNO3/c19-15-5-1-14(2-6-15)11-18(23)24-12-17(22)21-10-9-13-3-7-16(20)8-4-13/h1-8H,9-12H2,(H,21,22) |
| InChIKey | PGDGBJKLFVGVPB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |