C18H17Cl2NO3 — CID 9229357
[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-chlorophenyl)acetate (PubChem CID 9229357) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 9229357 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(Cl)cc1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO3/c19-15-6-4-14(5-7-15)11-18(23)24-12-17(22)21-9-8-13-2-1-3-16(20)10-13/h1-7,10H,8-9,11-12H2,(H,21,22) |
| InChIKey | IPALCWNUEKDTGG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |