C19H19ClFNO4 — CID 8667611
[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 8667611) has the molecular formula C19H19ClFNO4 and a molecular weight of 379.82 g/mol. Its IUPAC name is [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8667611 |
| Molecular Formula | C19H19ClFNO4 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)NCCc2cccc(Cl)c2)cc1F |
| InChI | InChI=1S/C19H19ClFNO4/c1-25-17-6-5-14(10-16(17)21)11-19(24)26-12-18(23)22-8-7-13-3-2-4-15(20)9-13/h2-6,9-10H,7-8,11-12H2,1H3,(H,22,23) |
| InChIKey | JMHBHKNMQGVALV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |