C14H17FN2O5 — CID 8667626
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 8667626) has the molecular formula C14H17FN2O5 and a molecular weight of 312.30 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8667626 |
| Molecular Formula | C14H17FN2O5 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | CNC(=O)CNC(=O)COC(=O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H17FN2O5/c1-16-12(18)7-17-13(19)8-22-14(20)6-9-3-4-11(21-2)10(15)5-9/h3-5H,6-8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | ZJASYQMKOIFXAP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |