C15H17FN2O5 — CID 8667447
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 8667447) has the molecular formula C15H17FN2O5 and a molecular weight of 324.31 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8667447 |
| Molecular Formula | C15H17FN2O5 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)NC(=O)NC2CC2)cc1F |
| InChI | InChI=1S/C15H17FN2O5/c1-22-12-5-2-9(6-11(12)16)7-14(20)23-8-13(19)18-15(21)17-10-3-4-10/h2,5-6,10H,3-4,7-8H2,1H3,(H2,17,18,19,21) |
| InChIKey | BOHZSACPXVTWHO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |