C17H21FN2O4 — CID 9460662
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate (PubChem CID 9460662) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 9460662 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-(3-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1cccc(F)c1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21FN2O4/c18-13-6-4-5-12(9-13)10-16(22)24-11-15(21)20-17(23)19-14-7-2-1-3-8-14/h4-6,9,14H,1-3,7-8,10-11H2,(H2,19,20,21,23) |
| InChIKey | JNHMKKGUBMEYRS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |