C19H24F3NO3 — CID 35564776
[2-(cyclooctylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 35564776) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 35564776 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(COC(=O)Cc1cccc(C(F)(F)F)c1)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H24F3NO3/c20-19(21,22)15-8-6-7-14(11-15)12-18(25)26-13-17(24)23-16-9-4-2-1-3-5-10-16/h6-8,11,16H,1-5,9-10,12-13H2,(H,23,24) |
| InChIKey | ZBSKQHKIHIJBHI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |