C15H18F3NO2S — CID 95169267
N-cyclopentyl-2-[(S)-[3-(trifluoromethyl)phenyl]methylsulfinyl]acetamide (PubChem CID 95169267) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is N-cyclopentyl-2-[(S)-[3-(trifluoromethyl)phenyl]methylsulfinyl]acetamide.
| Compound Name | N-cyclopentyl-2-[(S)-[3-(trifluoromethyl)phenyl]methylsulfinyl]acetamide |
|---|---|
| PubChem CID | 95169267 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-cyclopentyl-2-[(S)-[3-(trifluoromethyl)phenyl]methylsulfinyl]acetamide |
| SMILES | O=C(C[S@@](=O)Cc1cccc(C(F)(F)F)c1)NC1CCCC1 |
| InChI | InChI=1S/C15H18F3NO2S/c16-15(17,18)12-5-3-4-11(8-12)9-22(21)10-14(20)19-13-6-1-2-7-13/h3-5,8,13H,1-2,6-7,9-10H2,(H,19,20)/t22-/m0/s1 |
| InChIKey | IXNPIYCSOYQQNJ-QFIPXVFZSA-N |
| XLogP | 3.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |