C18H15F3N2O4 — CID 7767549
[2-(2-carbamoylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 7767549) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is [2-(2-carbamoylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 7767549 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | NC(=O)c1ccccc1NC(=O)COC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N2O4/c19-18(20,21)12-5-3-4-11(8-12)9-16(25)27-10-15(24)23-14-7-2-1-6-13(14)17(22)26/h1-8H,9-10H2,(H2,22,26)(H,23,24) |
| InChIKey | DUBWTWLTPBXQDK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |