C15H17F3O — CID 55095836
1-cyclohexyl-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 55095836) has the molecular formula C15H17F3O and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-cyclohexyl-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-cyclohexyl-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 55095836 |
| Molecular Formula | C15H17F3O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-cyclohexyl-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H17F3O/c16-15(17,18)13-8-4-5-11(9-13)10-14(19)12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10H2 |
| InChIKey | NQVZSUCJEGCZRN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |