C12H13FO — CID 61078433
1-cyclobutyl-2-(3-fluorophenyl)ethanone (PubChem CID 61078433) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 1-cyclobutyl-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-cyclobutyl-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 61078433 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-cyclobutyl-2-(3-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)C1CCC1 |
| InChI | InChI=1S/C12H13FO/c13-11-6-1-3-9(7-11)8-12(14)10-4-2-5-10/h1,3,6-7,10H,2,4-5,8H2 |
| InChIKey | ILOVWYTXXQEMBO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |