C14H18FNO — CID 116557206
1-(4-aminocyclohexyl)-2-(3-fluorophenyl)ethanone (PubChem CID 116557206) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-(4-aminocyclohexyl)-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116557206 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(4-aminocyclohexyl)-2-(3-fluorophenyl)ethanone |
| SMILES | NC1CCC(C(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C14H18FNO/c15-12-3-1-2-10(8-12)9-14(17)11-4-6-13(16)7-5-11/h1-3,8,11,13H,4-7,9,16H2 |
| InChIKey | AOODPQVIAPHUDX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |