C13H15FO2 — CID 81330350
2-(3-fluorophenyl)-1-(5-methyloxolan-2-yl)ethanone (PubChem CID 81330350) has the molecular formula C13H15FO2 and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(5-methyloxolan-2-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-(5-methyloxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 81330350 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(5-methyloxolan-2-yl)ethanone |
| SMILES | CC1CCC(C(=O)Cc2cccc(F)c2)O1 |
| InChI | InChI=1S/C13H15FO2/c1-9-5-6-13(16-9)12(15)8-10-3-2-4-11(14)7-10/h2-4,7,9,13H,5-6,8H2,1H3 |
| InChIKey | FFLBALPROZGYGF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |