C15H16F4O — CID 104622235
2-(3-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone (PubChem CID 104622235) has the molecular formula C15H16F4O and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 104622235 |
| Molecular Formula | C15H16F4O |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone |
| SMILES | O=C(Cc1cccc(F)c1)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H16F4O/c16-11-5-3-4-10(8-11)9-14(20)12-6-1-2-7-13(12)15(17,18)19/h3-5,8,12-13H,1-2,6-7,9H2 |
| InChIKey | PDADHDJIVGANMA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |