C15H16ClF3O — CID 104622227
2-(2-chlorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone (PubChem CID 104622227) has the molecular formula C15H16ClF3O and a molecular weight of 304.74 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 104622227 |
| Molecular Formula | C15H16ClF3O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[2-(trifluoromethyl)cyclohexyl]ethanone |
| SMILES | O=C(Cc1ccccc1Cl)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H16ClF3O/c16-13-8-4-1-5-10(13)9-14(20)11-6-2-3-7-12(11)15(17,18)19/h1,4-5,8,11-12H,2-3,6-7,9H2 |
| InChIKey | JECHAPMZKRJKOZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |