C14H16ClFO — CID 107187655
2-(3-chloro-2-fluorophenyl)-1-(2-methylcyclopentyl)ethanone (PubChem CID 107187655) has the molecular formula C14H16ClFO and a molecular weight of 254.73 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(2-methylcyclopentyl)ethanone.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(2-methylcyclopentyl)ethanone |
|---|---|
| PubChem CID | 107187655 |
| Molecular Formula | C14H16ClFO |
| Molecular Weight | 254.73 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(2-methylcyclopentyl)ethanone |
| SMILES | CC1CCCC1C(=O)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C14H16ClFO/c1-9-4-2-6-11(9)13(17)8-10-5-3-7-12(15)14(10)16/h3,5,7,9,11H,2,4,6,8H2,1H3 |
| InChIKey | FOIYWIHCTZVVGR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |