C14H14ClFO — CID 102865627
1-(6-bicyclo[3.1.0]hexanyl)-2-(3-chloro-2-fluorophenyl)ethanone (PubChem CID 102865627) has the molecular formula C14H14ClFO and a molecular weight of 252.72 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-2-(3-chloro-2-fluorophenyl)ethanone.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(3-chloro-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 102865627 |
| Molecular Formula | C14H14ClFO |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(3-chloro-2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1F)C1C2CCCC21 |
| InChI | InChI=1S/C14H14ClFO/c15-11-6-1-3-8(14(11)16)7-12(17)13-9-4-2-5-10(9)13/h1,3,6,9-10,13H,2,4-5,7H2 |
| InChIKey | NBQGOJMMEKZGGA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |