C18H16ClFO — CID 114602079
2-(3-chloro-2-fluorophenyl)-1-(2-cyclobutylphenyl)ethanone (PubChem CID 114602079) has the molecular formula C18H16ClFO and a molecular weight of 302.78 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(2-cyclobutylphenyl)ethanone.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(2-cyclobutylphenyl)ethanone |
|---|---|
| PubChem CID | 114602079 |
| Molecular Formula | C18H16ClFO |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(2-cyclobutylphenyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1F)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C18H16ClFO/c19-16-10-4-7-13(18(16)20)11-17(21)15-9-2-1-8-14(15)12-5-3-6-12/h1-2,4,7-10,12H,3,5-6,11H2 |
| InChIKey | ZKXQOTIJJDWYRG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |