C13H13F3O — CID 114601765
1-(2-cyclobutylphenyl)-3,3,3-trifluoropropan-1-one (PubChem CID 114601765) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-(2-cyclobutylphenyl)-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 114601765 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C13H13F3O/c14-13(15,16)8-12(17)11-7-2-1-6-10(11)9-4-3-5-9/h1-2,6-7,9H,3-5,8H2 |
| InChIKey | GHMNFOKRRHDBSJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |