C18H26O — CID 115813607
1-(2-cyclobutylphenyl)-3,4,4-trimethylpentan-1-one (PubChem CID 115813607) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(2-cyclobutylphenyl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 115813607 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-3,4,4-trimethylpentan-1-one |
| SMILES | CC(CC(=O)c1ccccc1C1CCC1)C(C)(C)C |
| InChI | InChI=1S/C18H26O/c1-13(18(2,3)4)12-17(19)16-11-6-5-10-15(16)14-8-7-9-14/h5-6,10-11,13-14H,7-9,12H2,1-4H3 |
| InChIKey | DRWYNZUQSJLNQI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |