C15H20O — CID 114601747
1-(2-cyclobutylphenyl)-2,2-dimethylpropan-1-one (PubChem CID 114601747) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(2-cyclobutylphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 114601747 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C15H20O/c1-15(2,3)14(16)13-10-5-4-9-12(13)11-7-6-8-11/h4-5,9-11H,6-8H2,1-3H3 |
| InChIKey | TXFGBHDUUSBMMQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |