About (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate
(2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate (PubChem CID 88809968) has the molecular formula C25H26O5
and a molecular weight of 406.48 g/mol. Its IUPAC name is (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate.
Molecular Properties
| Compound Name | (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate |
| PubChem CID | 88809968 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate |
| SMILES | O=C(OC(=O)c1ccccc1C1CCCC1)OC(=O)c1ccccc1C1CCCC1 |
| InChI | InChI=1S/C25H26O5/c26-23(21-15-7-5-13-19(21)17-9-1-2-10-17)29-25(28)30-24(27)22-16-8-6-14-20(22)18-11-3-4-12-18/h5-8,13-18H,1-4,9-12H2 |
| InChIKey | NBWBALVYDPZCOU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate?
The IUPAC name of (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate (CID 88809968) is (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate.
What is the SMILES notation for (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate?
The canonical SMILES for (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate is O=C(OC(=O)c1ccccc1C1CCCC1)OC(=O)c1ccccc1C1CCCC1.
What is the InChIKey of (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate?
The InChIKey is NBWBALVYDPZCOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O5/c26-23(21-15-7-5-13-19(21)17-9-1-2-10-17)29-25(28)30-24(27)22-16-8-6-14-20(22)18-11-3-4-12-18/h5-8,13-18H,1-4,9-12H2.
What are the key properties of (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate?
(2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate has a molecular weight of 406.48 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopentylbenzoyl)oxycarbonyl 2-cyclopentylbenzoate is sourced from PubChem (CID 88809968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).