C15H17F3O2 — CID 103146834
1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103146834) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103146834 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C15H17F3O2/c16-15(17,18)10-20-9-8-14(19)13-7-2-1-6-12(13)11-4-3-5-11/h1-2,6-7,11H,3-5,8-10H2 |
| InChIKey | BXZLQEKYXPMIAW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|