C15H12ClF3O2 — CID 103206733
1-(4-chloronaphthalen-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103206733) has the molecular formula C15H12ClF3O2 and a molecular weight of 316.71 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206733 |
| Molecular Formula | C15H12ClF3O2 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H12ClF3O2/c16-13-6-5-12(10-3-1-2-4-11(10)13)14(20)7-8-21-9-15(17,18)19/h1-6H,7-9H2 |
| InChIKey | FWAWRYJFXOPCNA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|