C11H9ClF4O2 — CID 113230951
1-(4-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 113230951) has the molecular formula C11H9ClF4O2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 113230951 |
| Molecular Formula | C11H9ClF4O2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H9ClF4O2/c12-7-1-2-8(9(13)5-7)10(17)3-4-18-6-11(14,15)16/h1-2,5H,3-4,6H2 |
| InChIKey | ZTZHGTFUMUXGNU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|