C12H12F4O2 — CID 55096171
1-(4-fluoro-3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 55096171) has the molecular formula C12H12F4O2 and a molecular weight of 264.22 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 55096171 |
| Molecular Formula | C12H12F4O2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | Cc1cc(C(=O)CCOCC(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H12F4O2/c1-8-6-9(2-3-10(8)13)11(17)4-5-18-7-12(14,15)16/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | BZKJENQVAAXHJX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|