C13H14BrF3O2 — CID 103206700
1-(4-bromo-2,5-dimethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103206700) has the molecular formula C13H14BrF3O2 and a molecular weight of 339.15 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(4-bromo-2,5-dimethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206700 |
| Molecular Formula | C13H14BrF3O2 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1-(4-bromo-2,5-dimethylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | Cc1cc(C(=O)CCOCC(F)(F)F)c(C)cc1Br |
| InChI | InChI=1S/C13H14BrF3O2/c1-8-6-11(14)9(2)5-10(8)12(18)3-4-19-7-13(15,16)17/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | GUACPVVLNSYXKS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|