C12H13F3O2 — CID 55096503
1-(3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 55096503) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 55096503 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(3-methylphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | Cc1cccc(C(=O)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O2/c1-9-3-2-4-10(7-9)11(16)5-6-17-8-12(13,14)15/h2-4,7H,5-6,8H2,1H3 |
| InChIKey | FBBZBNUPUWMTCL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|