C13H12F3NO4 — CID 103206653
3-methyl-6-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3-benzoxazol-2-one (PubChem CID 103206653) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is 3-methyl-6-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 103206653 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-methyl-6-[3-(2,2,2-trifluoroethoxy)propanoyl]-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(C(=O)CCOCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H12F3NO4/c1-17-9-3-2-8(6-11(9)21-12(17)19)10(18)4-5-20-7-13(14,15)16/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | GCLSXKCCUZWWGF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|