C14H17NO3 — CID 55053743
6-hexanoyl-3-methyl-1,3-benzoxazol-2-one (PubChem CID 55053743) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 6-hexanoyl-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-hexanoyl-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 55053743 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 6-hexanoyl-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCCCCC(=O)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C14H17NO3/c1-3-4-5-6-12(16)10-7-8-11-13(9-10)18-14(17)15(11)2/h7-9H,3-6H2,1-2H3 |
| InChIKey | MKFWJZIVBBSPEX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|