C9H9N3O3 — CID 116843326
3-methyl-2-oxo-1,3-benzoxazole-6-carbohydrazide (PubChem CID 116843326) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-benzoxazole-6-carbohydrazide.
| Compound Name | 3-methyl-2-oxo-1,3-benzoxazole-6-carbohydrazide |
|---|---|
| PubChem CID | 116843326 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-methyl-2-oxo-1,3-benzoxazole-6-carbohydrazide |
| SMILES | Cn1c(=O)oc2cc(C(=O)NN)ccc21 |
| InChI | InChI=1S/C9H9N3O3/c1-12-6-3-2-5(8(13)11-10)4-7(6)15-9(12)14/h2-4H,10H2,1H3,(H,11,13) |
| InChIKey | BNHSUWXAHWBWPS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|