C13H15N3O4 — CID 110766529
N-(2-acetamidoethyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide (PubChem CID 110766529) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110766529 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(2-acetamidoethyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C13H15N3O4/c1-8(17)14-5-6-15-12(18)9-3-4-10-11(7-9)20-13(19)16(10)2/h3-4,7H,5-6H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | KEOHIWQULLFDDR-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|