C15H11FN2O3 — CID 110766557
N-(4-fluorophenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide (PubChem CID 110766557) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110766557 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(4-fluorophenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-carboxamide |
| SMILES | Cn1c(=O)oc2cc(C(=O)Nc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C15H11FN2O3/c1-18-12-7-2-9(8-13(12)21-15(18)20)14(19)17-11-5-3-10(16)4-6-11/h2-8H,1H3,(H,17,19) |
| InChIKey | JMTQYQMDZXAAIX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |