C19H19FN2O3 — CID 110616444
5-(4-fluorophenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)pentanamide (PubChem CID 110616444) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)pentanamide.
| Compound Name | 5-(4-fluorophenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)pentanamide |
|---|---|
| PubChem CID | 110616444 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)pentanamide |
| SMILES | Cn1c(=O)oc2cc(NC(=O)CCCCc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C19H19FN2O3/c1-22-16-11-10-15(12-17(16)25-19(22)24)21-18(23)5-3-2-4-13-6-8-14(20)9-7-13/h6-12H,2-5H2,1H3,(H,21,23) |
| InChIKey | HKLNTYFRPFJDSV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|