C13H17N3O3 — CID 116846543
N'-methyl-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanehydrazide (PubChem CID 116846543) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N'-methyl-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanehydrazide.
| Compound Name | N'-methyl-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanehydrazide |
|---|---|
| PubChem CID | 116846543 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N'-methyl-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanehydrazide |
| SMILES | CNNC(=O)CCCc1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C13H17N3O3/c1-14-15-12(17)5-3-4-9-6-7-10-11(8-9)19-13(18)16(10)2/h6-8,14H,3-5H2,1-2H3,(H,15,17) |
| InChIKey | ZQNVKJFSFOQJOE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|