C13H16N2O3 — CID 115235713
3-methyl-6-[(3-oxobutylamino)methyl]-1,3-benzoxazol-2-one (PubChem CID 115235713) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-methyl-6-[(3-oxobutylamino)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[(3-oxobutylamino)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115235713 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-methyl-6-[(3-oxobutylamino)methyl]-1,3-benzoxazol-2-one |
| SMILES | CC(=O)CCNCc1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C13H16N2O3/c1-9(16)5-6-14-8-10-3-4-11-12(7-10)18-13(17)15(11)2/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | VYTOFHSUWFDNTL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|