C12H13ClN2O3 — CID 115162152
2-chloro-N-[2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)ethyl]acetamide (PubChem CID 115162152) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 115162152 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-chloro-N-[2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)ethyl]acetamide |
| SMILES | Cn1c(=O)oc2cc(CCNC(=O)CCl)ccc21 |
| InChI | InChI=1S/C12H13ClN2O3/c1-15-9-3-2-8(4-5-14-11(16)7-13)6-10(9)18-12(15)17/h2-3,6H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | HJTZHUKQPREJPP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|