C13H15N3O2 — CID 115231741
4-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]butanenitrile (PubChem CID 115231741) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]butanenitrile.
| Compound Name | 4-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 115231741 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]butanenitrile |
| SMILES | Cn1c(=O)oc2cc(CNCCCC#N)ccc21 |
| InChI | InChI=1S/C13H15N3O2/c1-16-11-5-4-10(8-12(11)18-13(16)17)9-15-7-3-2-6-14/h4-5,8,15H,2-3,7,9H2,1H3 |
| InChIKey | FQCSJATYORQDGJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|