C9H9N3O2 — CID 89345926
6-(diazenylmethyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 89345926) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 6-(diazenylmethyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(diazenylmethyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 89345926 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 6-(diazenylmethyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | [H]/N=N/Cc1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C9H9N3O2/c1-12-7-3-2-6(5-11-10)4-8(7)14-9(12)13/h2-4,10H,5H2,1H3/b11-10+ |
| InChIKey | CBNQPWVTXVVAGT-ZHACJKMWSA-N |
| XLogP | 1.66 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|