C12H16N2O2S — CID 115224142
3-methyl-6-[[methyl(2-sulfanylethyl)amino]methyl]-1,3-benzoxazol-2-one (PubChem CID 115224142) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-methyl-6-[[methyl(2-sulfanylethyl)amino]methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[[methyl(2-sulfanylethyl)amino]methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115224142 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-methyl-6-[[methyl(2-sulfanylethyl)amino]methyl]-1,3-benzoxazol-2-one |
| SMILES | CN(CCS)Cc1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C12H16N2O2S/c1-13(5-6-17)8-9-3-4-10-11(7-9)16-12(15)14(10)2/h3-4,7,17H,5-6,8H2,1-2H3 |
| InChIKey | AGSSGOCQHPUPPO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|