C14H21N3O2 — CID 115197940
3-methyl-5-[[methyl-[3-(methylamino)propyl]amino]methyl]-1,3-benzoxazol-2-one (PubChem CID 115197940) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-methyl-5-[[methyl-[3-(methylamino)propyl]amino]methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-5-[[methyl-[3-(methylamino)propyl]amino]methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115197940 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 3-methyl-5-[[methyl-[3-(methylamino)propyl]amino]methyl]-1,3-benzoxazol-2-one |
| SMILES | CNCCCN(C)Cc1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C14H21N3O2/c1-15-7-4-8-16(2)10-11-5-6-13-12(9-11)17(3)14(18)19-13/h5-6,9,15H,4,7-8,10H2,1-3H3 |
| InChIKey | MLGLGHUOPRRCJB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|