C12H17N3O2 — CID 115227229
3-methyl-5-[2-(methylaminomethylamino)ethyl]-1,3-benzoxazol-2-one (PubChem CID 115227229) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-methyl-5-[2-(methylaminomethylamino)ethyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-5-[2-(methylaminomethylamino)ethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115227229 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-methyl-5-[2-(methylaminomethylamino)ethyl]-1,3-benzoxazol-2-one |
| SMILES | CNCNCCc1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C12H17N3O2/c1-13-8-14-6-5-9-3-4-11-10(7-9)15(2)12(16)17-11/h3-4,7,13-14H,5-6,8H2,1-2H3 |
| InChIKey | OTGZGYQENNAHIY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|