C9H11N2O2+ — CID 143272906
(3-methyl-2-oxo-1,3-benzoxazol-5-yl)methylazanium (PubChem CID 143272906) has the molecular formula C9H11N2O2+ and a molecular weight of 179.20 g/mol. Its IUPAC name is (3-methyl-2-oxo-1,3-benzoxazol-5-yl)methylazanium.
| Compound Name | (3-methyl-2-oxo-1,3-benzoxazol-5-yl)methylazanium |
|---|---|
| PubChem CID | 143272906 |
| Molecular Formula | C9H11N2O2+ |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (3-methyl-2-oxo-1,3-benzoxazol-5-yl)methylazanium |
| SMILES | Cn1c(=O)oc2ccc(C[NH3+])cc21 |
| InChI | InChI=1S/C9H10N2O2/c1-11-7-4-6(5-10)2-3-8(7)13-9(11)12/h2-4H,5,10H2,1H3/p+1 |
| InChIKey | IHFCXBBSRKHLQX-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |