C15H22N2O2 — CID 14751611
6-[3-(diethylamino)propyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 14751611) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 6-[3-(diethylamino)propyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[3-(diethylamino)propyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 14751611 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 6-[3-(diethylamino)propyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCN(CC)CCCc1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C15H22N2O2/c1-4-17(5-2)10-6-7-12-8-9-13-14(11-12)19-15(18)16(13)3/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | GKXMIGRLYGTEPR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |