C12H13N3O2 — CID 116940059
4-amino-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanenitrile (PubChem CID 116940059) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-amino-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanenitrile.
| Compound Name | 4-amino-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanenitrile |
|---|---|
| PubChem CID | 116940059 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-amino-4-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)butanenitrile |
| SMILES | Cn1c(=O)oc2cc(C(N)CCC#N)ccc21 |
| InChI | InChI=1S/C12H13N3O2/c1-15-10-5-4-8(9(14)3-2-6-13)7-11(10)17-12(15)16/h4-5,7,9H,2-3,14H2,1H3 |
| InChIKey | ATEUYCJQVMXHPM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |