C17H26N2O2 — CID 65447465
6-(1-aminononyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 65447465) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 6-(1-aminononyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-aminononyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 65447465 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 6-(1-aminononyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCCCCCCCC(N)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C17H26N2O2/c1-3-4-5-6-7-8-9-14(18)13-10-11-15-16(12-13)21-17(20)19(15)2/h10-12,14H,3-9,18H2,1-2H3 |
| InChIKey | PACCSJAYFBYFDB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|