C16H23NO3 — CID 82987811
6-(1-hydroxy-2-propylpentyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 82987811) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 6-(1-hydroxy-2-propylpentyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-hydroxy-2-propylpentyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82987811 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 6-(1-hydroxy-2-propylpentyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCCC(CCC)C(O)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C16H23NO3/c1-4-6-11(7-5-2)15(18)12-8-9-13-14(10-12)20-16(19)17(13)3/h8-11,15,18H,4-7H2,1-3H3 |
| InChIKey | UXXCXFIHEUBPSB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |