C15H20N2O4 — CID 62298655
methyl 4-amino-4-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)butanoate (PubChem CID 62298655) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 4-amino-4-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)butanoate.
| Compound Name | methyl 4-amino-4-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)butanoate |
|---|---|
| PubChem CID | 62298655 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 4-amino-4-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)butanoate |
| SMILES | CCCn1c(=O)oc2cc(C(N)CCC(=O)OC)ccc21 |
| InChI | InChI=1S/C15H20N2O4/c1-3-8-17-12-6-4-10(9-13(12)21-15(17)19)11(16)5-7-14(18)20-2/h4,6,9,11H,3,5,7-8,16H2,1-2H3 |
| InChIKey | GQGIYUYBIVSNKI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |