C16H23NO3 — CID 62298658
6-(1-hydroxy-3,3-dimethylbutyl)-3-propyl-1,3-benzoxazol-2-one (PubChem CID 62298658) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 6-(1-hydroxy-3,3-dimethylbutyl)-3-propyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-hydroxy-3,3-dimethylbutyl)-3-propyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62298658 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 6-(1-hydroxy-3,3-dimethylbutyl)-3-propyl-1,3-benzoxazol-2-one |
| SMILES | CCCn1c(=O)oc2cc(C(O)CC(C)(C)C)ccc21 |
| InChI | InChI=1S/C16H23NO3/c1-5-8-17-12-7-6-11(9-14(12)20-15(17)19)13(18)10-16(2,3)4/h6-7,9,13,18H,5,8,10H2,1-4H3 |
| InChIKey | XWZXHYFPTCDCLV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |