C14H20N2O3 — CID 82341307
6-(4-amino-1-hydroxybutyl)-3-propyl-1,3-benzoxazol-2-one (PubChem CID 82341307) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(4-amino-1-hydroxybutyl)-3-propyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(4-amino-1-hydroxybutyl)-3-propyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82341307 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 6-(4-amino-1-hydroxybutyl)-3-propyl-1,3-benzoxazol-2-one |
| SMILES | CCCn1c(=O)oc2cc(C(O)CCCN)ccc21 |
| InChI | InChI=1S/C14H20N2O3/c1-2-8-16-11-6-5-10(12(17)4-3-7-15)9-13(11)19-14(16)18/h5-6,9,12,17H,2-4,7-8,15H2,1H3 |
| InChIKey | WKXVWNAKDHKVQP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |